C13H22O3 — CID 10656867
(E)-4-[(1S,4R,6S)-1,4-dihydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one (PubChem CID 10656867) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (E)-4-[(1S,4R,6S)-1,4-dihydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one.
| Compound Name | (E)-4-[(1S,4R,6S)-1,4-dihydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one |
|---|---|
| PubChem CID | 10656867 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (E)-4-[(1S,4R,6S)-1,4-dihydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/[C@@]1(O)[C@@H](C)C[C@@H](O)CC1(C)C |
| InChI | InChI=1S/C13H22O3/c1-9-7-11(15)8-12(3,4)13(9,16)6-5-10(2)14/h5-6,9,11,15-16H,7-8H2,1-4H3/b6-5+/t9-,11+,13+/m0/s1 |
| InChIKey | CWLKAPCFJXJCEO-WWTVHFDRSA-N |
| XLogP | 1.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|