C9H11NO4S — CID 10657019
9-methyl-4,4-dioxo-4λ6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione (PubChem CID 10657019) has the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. Its IUPAC name is 9-methyl-4,4-dioxo-4λ6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione.
| Compound Name | 9-methyl-4,4-dioxo-4λ6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione |
|---|---|
| PubChem CID | 10657019 |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 9-methyl-4,4-dioxo-4λ6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione |
| SMILES | CN1C(=O)C2C3CS(=O)(=O)CC3C2C1=O |
| InChI | InChI=1S/C9H11NO4S/c1-10-8(11)6-4-2-15(13,14)3-5(4)7(6)9(10)12/h4-7H,2-3H2,1H3 |
| InChIKey | PHAJLGUYNRAZDA-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|