C12H23N3 — CID 106570359
4-methyl-1-(2-methylbutyl)-N-propan-2-ylimidazol-2-amine (PubChem CID 106570359) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 4-methyl-1-(2-methylbutyl)-N-propan-2-ylimidazol-2-amine.
| Compound Name | 4-methyl-1-(2-methylbutyl)-N-propan-2-ylimidazol-2-amine |
|---|---|
| PubChem CID | 106570359 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 4-methyl-1-(2-methylbutyl)-N-propan-2-ylimidazol-2-amine |
| SMILES | CCC(C)Cn1cc(C)nc1NC(C)C |
| InChI | InChI=1S/C12H23N3/c1-6-10(4)7-15-8-11(5)14-12(15)13-9(2)3/h8-10H,6-7H2,1-5H3,(H,13,14) |
| InChIKey | LODVLVBIYGMLJO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |