About N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-N'-ethyl-N'-methylethane-1,2-diamine
N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-N'-ethyl-N'-methylethane-1,2-diamine (PubChem CID 106570399) has the molecular formula C14H28N4O
and a molecular weight of 268.40 g/mol. Its IUPAC name is N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-N'-ethyl-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-N'-ethyl-N'-methylethane-1,2-diamine |
| PubChem CID | 106570399 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-N'-ethyl-N'-methylethane-1,2-diamine |
| SMILES | CCOCCCn1cc(C)nc1NCCN(C)CC |
| InChI | InChI=1S/C14H28N4O/c1-5-17(4)10-8-15-14-16-13(3)12-18(14)9-7-11-19-6-2/h12H,5-11H2,1-4H3,(H,15,16) |
| InChIKey | RERRUSFVLZHROQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-N'-ethyl-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-N'-ethyl-N'-methylethane-1,2-diamine?
The IUPAC name of N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-N'-ethyl-N'-methylethane-1,2-diamine (CID 106570399) is N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-N'-ethyl-N'-methylethane-1,2-diamine.
What is the SMILES notation for N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-N'-ethyl-N'-methylethane-1,2-diamine?
The canonical SMILES for N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-N'-ethyl-N'-methylethane-1,2-diamine is CCOCCCn1cc(C)nc1NCCN(C)CC.
What is the InChIKey of N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-N'-ethyl-N'-methylethane-1,2-diamine?
The InChIKey is RERRUSFVLZHROQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N4O/c1-5-17(4)10-8-15-14-16-13(3)12-18(14)9-7-11-19-6-2/h12H,5-11H2,1-4H3,(H,15,16).
What are the key properties of N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-N'-ethyl-N'-methylethane-1,2-diamine?
N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-N'-ethyl-N'-methylethane-1,2-diamine has a molecular weight of 268.40 g/mol, XLogP of 1.98, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-N'-ethyl-N'-methylethane-1,2-diamine is sourced from PubChem (CID 106570399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).