C13H18N4S — CID 106571890
N-cyclopentyl-1-[2-(1,3-thiazol-2-yl)ethyl]imidazol-2-amine (PubChem CID 106571890) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is N-cyclopentyl-1-[2-(1,3-thiazol-2-yl)ethyl]imidazol-2-amine.
| Compound Name | N-cyclopentyl-1-[2-(1,3-thiazol-2-yl)ethyl]imidazol-2-amine |
|---|---|
| PubChem CID | 106571890 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-cyclopentyl-1-[2-(1,3-thiazol-2-yl)ethyl]imidazol-2-amine |
| SMILES | c1csc(CCn2ccnc2NC2CCCC2)n1 |
| InChI | InChI=1S/C13H18N4S/c1-2-4-11(3-1)16-13-15-6-9-17(13)8-5-12-14-7-10-18-12/h6-7,9-11H,1-5,8H2,(H,15,16) |
| InChIKey | OOQSBTHWZOILPQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |