C10H12F2O2S — CID 10657326
(2R)-1,1-difluoro-3-[(R)-(4-methylphenyl)sulfinyl]propan-2-ol (PubChem CID 10657326) has the molecular formula C10H12F2O2S and a molecular weight of 234.27 g/mol. Its IUPAC name is (2R)-1,1-difluoro-3-[(R)-(4-methylphenyl)sulfinyl]propan-2-ol.
| Compound Name | (2R)-1,1-difluoro-3-[(R)-(4-methylphenyl)sulfinyl]propan-2-ol |
|---|---|
| PubChem CID | 10657326 |
| Molecular Formula | C10H12F2O2S |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | (2R)-1,1-difluoro-3-[(R)-(4-methylphenyl)sulfinyl]propan-2-ol |
| SMILES | Cc1ccc([S@](=O)C[C@H](O)C(F)F)cc1 |
| InChI | InChI=1S/C10H12F2O2S/c1-7-2-4-8(5-3-7)15(14)6-9(13)10(11)12/h2-5,9-10,13H,6H2,1H3/t9-,15+/m0/s1 |
| InChIKey | IWXNBCLGKBFRGN-BJOHPYRUSA-N |
| XLogP | 1.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |