C11H10F2N4 — CID 10657439
1-[(2R)-2-azidopropyl]-5,6-difluoroindole (PubChem CID 10657439) has the molecular formula C11H10F2N4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 1-[(2R)-2-azidopropyl]-5,6-difluoroindole.
| Compound Name | 1-[(2R)-2-azidopropyl]-5,6-difluoroindole |
|---|---|
| PubChem CID | 10657439 |
| Molecular Formula | C11H10F2N4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 1-[(2R)-2-azidopropyl]-5,6-difluoroindole |
| SMILES | C[C@H](Cn1ccc2cc(F)c(F)cc21)N=[N+]=[N-] |
| InChI | InChI=1S/C11H10F2N4/c1-7(15-16-14)6-17-3-2-8-4-9(12)10(13)5-11(8)17/h2-5,7H,6H2,1H3/t7-/m1/s1 |
| InChIKey | GVMHQKGONLCVJH-SSDOTTSWSA-N |
| XLogP | 3.62 |
| TPSA | 53.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|