C13H16O4 — CID 10657446
[(1R,2R,3S,6R,7S,8R,9R)-11,12-dioxatetracyclo[7.2.1.13,6.02,7]tridec-4-en-8-yl] acetate (PubChem CID 10657446) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is [(1R,2R,3S,6R,7S,8R,9R)-11,12-dioxatetracyclo[7.2.1.13,6.02,7]tridec-4-en-8-yl] acetate.
| Compound Name | [(1R,2R,3S,6R,7S,8R,9R)-11,12-dioxatetracyclo[7.2.1.13,6.02,7]tridec-4-en-8-yl] acetate |
|---|---|
| PubChem CID | 10657446 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | [(1R,2R,3S,6R,7S,8R,9R)-11,12-dioxatetracyclo[7.2.1.13,6.02,7]tridec-4-en-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2[C@H]([C@@H]3OC[C@H]1O3)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C13H16O4/c1-6(14)16-12-9-5-15-13(17-9)11-8-3-2-7(4-8)10(11)12/h2-3,7-13H,4-5H2,1H3/t7-,8+,9+,10-,11+,12-,13+/m0/s1 |
| InChIKey | KWACLLHEBSTRHD-BYOMWJCZSA-N |
| XLogP | 1.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|