C13H18N4S — CID 106574986
4-methyl-N-prop-2-enyl-1-[1-(1,3-thiazol-2-yl)propyl]imidazol-2-amine (PubChem CID 106574986) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is 4-methyl-N-prop-2-enyl-1-[1-(1,3-thiazol-2-yl)propyl]imidazol-2-amine.
| Compound Name | 4-methyl-N-prop-2-enyl-1-[1-(1,3-thiazol-2-yl)propyl]imidazol-2-amine |
|---|---|
| PubChem CID | 106574986 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 4-methyl-N-prop-2-enyl-1-[1-(1,3-thiazol-2-yl)propyl]imidazol-2-amine |
| SMILES | C=CCNc1nc(C)cn1C(CC)c1nccs1 |
| InChI | InChI=1S/C13H18N4S/c1-4-6-15-13-16-10(3)9-17(13)11(5-2)12-14-7-8-18-12/h4,7-9,11H,1,5-6H2,2-3H3,(H,15,16) |
| InChIKey | VNVBKOJLFXGMCO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|