C12H16ClN3S — CID 106575432
1-[(5-chlorothiophen-2-yl)methyl]-N-(2-methylpropyl)imidazol-2-amine (PubChem CID 106575432) has the molecular formula C12H16ClN3S and a molecular weight of 269.80 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-N-(2-methylpropyl)imidazol-2-amine.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-N-(2-methylpropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106575432 |
| Molecular Formula | C12H16ClN3S |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-N-(2-methylpropyl)imidazol-2-amine |
| SMILES | CC(C)CNc1nccn1Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H16ClN3S/c1-9(2)7-15-12-14-5-6-16(12)8-10-3-4-11(13)17-10/h3-6,9H,7-8H2,1-2H3,(H,14,15) |
| InChIKey | RCSWCSIVIKRETO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |