C11H12BrN3S — CID 106575655
N-[(4-bromothiophen-2-yl)methyl]-1-cyclopropylimidazol-2-amine (PubChem CID 106575655) has the molecular formula C11H12BrN3S and a molecular weight of 298.21 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-1-cyclopropylimidazol-2-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-1-cyclopropylimidazol-2-amine |
|---|---|
| PubChem CID | 106575655 |
| Molecular Formula | C11H12BrN3S |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-1-cyclopropylimidazol-2-amine |
| SMILES | Brc1csc(CNc2nccn2C2CC2)c1 |
| InChI | InChI=1S/C11H12BrN3S/c12-8-5-10(16-7-8)6-14-11-13-3-4-15(11)9-1-2-9/h3-5,7,9H,1-2,6H2,(H,13,14) |
| InChIKey | AAEMLWGRYBYIKK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |