C14H22O3 — CID 10657574
2-tert-butyl-6-hex-5-enyl-1,3-dioxin-4-one (PubChem CID 10657574) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-tert-butyl-6-hex-5-enyl-1,3-dioxin-4-one.
| Compound Name | 2-tert-butyl-6-hex-5-enyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 10657574 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 2-tert-butyl-6-hex-5-enyl-1,3-dioxin-4-one |
| SMILES | C=CCCCCC1=CC(=O)OC(C(C)(C)C)O1 |
| InChI | InChI=1S/C14H22O3/c1-5-6-7-8-9-11-10-12(15)17-13(16-11)14(2,3)4/h5,10,13H,1,6-9H2,2-4H3 |
| InChIKey | MQHMIQLEQRISGG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|