C13H25N3O2S — CID 106576362
4-methyl-1-(2-methyl-2-methylsulfonylpropyl)-N-(2-methylpropyl)imidazol-2-amine (PubChem CID 106576362) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is 4-methyl-1-(2-methyl-2-methylsulfonylpropyl)-N-(2-methylpropyl)imidazol-2-amine.
| Compound Name | 4-methyl-1-(2-methyl-2-methylsulfonylpropyl)-N-(2-methylpropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106576362 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 4-methyl-1-(2-methyl-2-methylsulfonylpropyl)-N-(2-methylpropyl)imidazol-2-amine |
| SMILES | Cc1cn(CC(C)(C)S(C)(=O)=O)c(NCC(C)C)n1 |
| InChI | InChI=1S/C13H25N3O2S/c1-10(2)7-14-12-15-11(3)8-16(12)9-13(4,5)19(6,17)18/h8,10H,7,9H2,1-6H3,(H,14,15) |
| InChIKey | KTBZUXYGMIHIDR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |