C13H13FIN3 — CID 106576412
1-cyclopropyl-N-(4-fluoro-2-iodophenyl)-4-methylimidazol-2-amine (PubChem CID 106576412) has the molecular formula C13H13FIN3 and a molecular weight of 357.17 g/mol. Its IUPAC name is 1-cyclopropyl-N-(4-fluoro-2-iodophenyl)-4-methylimidazol-2-amine.
| Compound Name | 1-cyclopropyl-N-(4-fluoro-2-iodophenyl)-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106576412 |
| Molecular Formula | C13H13FIN3 |
| Molecular Weight | 357.17 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 1-cyclopropyl-N-(4-fluoro-2-iodophenyl)-4-methylimidazol-2-amine |
| SMILES | Cc1cn(C2CC2)c(Nc2ccc(F)cc2I)n1 |
| InChI | InChI=1S/C13H13FIN3/c1-8-7-18(10-3-4-10)13(16-8)17-12-5-2-9(14)6-11(12)15/h2,5-7,10H,3-4H2,1H3,(H,16,17) |
| InChIKey | WFMBVBAVBMOTIZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.17 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|