C14H17BrClN3O — CID 106576622
1-(3-bromo-4-chlorophenyl)-N-(3-ethoxypropyl)imidazol-2-amine (PubChem CID 106576622) has the molecular formula C14H17BrClN3O and a molecular weight of 358.67 g/mol. Its IUPAC name is 1-(3-bromo-4-chlorophenyl)-N-(3-ethoxypropyl)imidazol-2-amine.
| Compound Name | 1-(3-bromo-4-chlorophenyl)-N-(3-ethoxypropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106576622 |
| Molecular Formula | C14H17BrClN3O |
| Molecular Weight | 358.67 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 1-(3-bromo-4-chlorophenyl)-N-(3-ethoxypropyl)imidazol-2-amine |
| SMILES | CCOCCCNc1nccn1-c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C14H17BrClN3O/c1-2-20-9-3-6-17-14-18-7-8-19(14)11-4-5-13(16)12(15)10-11/h4-5,7-8,10H,2-3,6,9H2,1H3,(H,17,18) |
| InChIKey | LURSPCJIUDPTHT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.67 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|