C16H25N3OS — CID 106577043
1-(3-methoxypropyl)-4-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)imidazol-2-amine (PubChem CID 106577043) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-4-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)imidazol-2-amine.
| Compound Name | 1-(3-methoxypropyl)-4-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106577043 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-(3-methoxypropyl)-4-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)imidazol-2-amine |
| SMILES | COCCCn1cc(C)nc1NCC(C)(C)c1cccs1 |
| InChI | InChI=1S/C16H25N3OS/c1-13-11-19(8-6-9-20-4)15(18-13)17-12-16(2,3)14-7-5-10-21-14/h5,7,10-11H,6,8-9,12H2,1-4H3,(H,17,18) |
| InChIKey | LOUHIFYAFMKQRI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|