C14H25N3OS — CID 106578191
N-(3-ethoxypropyl)-1-[(2-methylthiolan-2-yl)methyl]imidazol-2-amine (PubChem CID 106578191) has the molecular formula C14H25N3OS and a molecular weight of 283.44 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-1-[(2-methylthiolan-2-yl)methyl]imidazol-2-amine.
| Compound Name | N-(3-ethoxypropyl)-1-[(2-methylthiolan-2-yl)methyl]imidazol-2-amine |
|---|---|
| PubChem CID | 106578191 |
| Molecular Formula | C14H25N3OS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N-(3-ethoxypropyl)-1-[(2-methylthiolan-2-yl)methyl]imidazol-2-amine |
| SMILES | CCOCCCNc1nccn1CC1(C)CCCS1 |
| InChI | InChI=1S/C14H25N3OS/c1-3-18-10-5-7-15-13-16-8-9-17(13)12-14(2)6-4-11-19-14/h8-9H,3-7,10-12H2,1-2H3,(H,15,16) |
| InChIKey | CSDUNJVCFSEMDT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|