About 1-isocyanatopyrene
1-isocyanatopyrene (PubChem CID 10657849) has the molecular formula C17H9NO
and a molecular weight of 243.26 g/mol. Its IUPAC name is 1-isocyanatopyrene.
Molecular Properties
| Compound Name | 1-isocyanatopyrene |
| PubChem CID | 10657849 |
| Molecular Formula | C17H9NO |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 1-isocyanatopyrene |
| SMILES | O=C=Nc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C17H9NO/c19-10-18-15-9-7-13-5-4-11-2-1-3-12-6-8-14(15)17(13)16(11)12/h1-9H |
| InChIKey | ORMKUBWIWXXRRL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanatopyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanatopyrene?
The IUPAC name of 1-isocyanatopyrene (CID 10657849) is 1-isocyanatopyrene.
What is the SMILES notation for 1-isocyanatopyrene?
The canonical SMILES for 1-isocyanatopyrene is O=C=Nc1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of 1-isocyanatopyrene?
The InChIKey is ORMKUBWIWXXRRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9NO/c19-10-18-15-9-7-13-5-4-11-2-1-3-12-6-8-14(15)17(13)16(11)12/h1-9H.
What are the key properties of 1-isocyanatopyrene?
1-isocyanatopyrene has a molecular weight of 243.26 g/mol, XLogP of 4.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanatopyrene is sourced from PubChem (CID 10657849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).