C11H16O6 — CID 10657901
dimethyl 3-[(E)-prop-1-enyl]-1,4-dioxane-2,2-dicarboxylate (PubChem CID 10657901) has the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. Its IUPAC name is dimethyl 3-[(E)-prop-1-enyl]-1,4-dioxane-2,2-dicarboxylate.
| Compound Name | dimethyl 3-[(E)-prop-1-enyl]-1,4-dioxane-2,2-dicarboxylate |
|---|---|
| PubChem CID | 10657901 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | dimethyl 3-[(E)-prop-1-enyl]-1,4-dioxane-2,2-dicarboxylate |
| SMILES | C/C=C/C1OCCOC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C11H16O6/c1-4-5-8-11(9(12)14-2,10(13)15-3)17-7-6-16-8/h4-5,8H,6-7H2,1-3H3/b5-4+ |
| InChIKey | NONMUVSCQBCFMD-SNAWJCMRSA-N |
| XLogP | 0.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|