C15H20N2O — CID 10657954
N-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl)-N-phenylformamide (PubChem CID 10657954) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is N-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl)-N-phenylformamide.
| Compound Name | N-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl)-N-phenylformamide |
|---|---|
| PubChem CID | 10657954 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl)-N-phenylformamide |
| SMILES | O=CN(CC12CCCN1CCC2)c1ccccc1 |
| InChI | InChI=1S/C15H20N2O/c18-13-16(14-6-2-1-3-7-14)12-15-8-4-10-17(15)11-5-9-15/h1-3,6-7,13H,4-5,8-12H2 |
| InChIKey | SPKWVXVYHMKXQH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|