C15H19N3S2 — CID 106580091
1-(1,4-dithian-2-ylmethyl)-4-methyl-N-phenylimidazol-2-amine (PubChem CID 106580091) has the molecular formula C15H19N3S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is 1-(1,4-dithian-2-ylmethyl)-4-methyl-N-phenylimidazol-2-amine.
| Compound Name | 1-(1,4-dithian-2-ylmethyl)-4-methyl-N-phenylimidazol-2-amine |
|---|---|
| PubChem CID | 106580091 |
| Molecular Formula | C15H19N3S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 1-(1,4-dithian-2-ylmethyl)-4-methyl-N-phenylimidazol-2-amine |
| SMILES | Cc1cn(CC2CSCCS2)c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C15H19N3S2/c1-12-9-18(10-14-11-19-7-8-20-14)15(16-12)17-13-5-3-2-4-6-13/h2-6,9,14H,7-8,10-11H2,1H3,(H,16,17) |
| InChIKey | IPSACRGWDLHHRD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |