C14H15BrClN3 — CID 106580684
N-(2-bromo-5-chloro-4-methylphenyl)-4-methyl-1-prop-2-enylimidazol-2-amine (PubChem CID 106580684) has the molecular formula C14H15BrClN3 and a molecular weight of 340.65 g/mol. Its IUPAC name is N-(2-bromo-5-chloro-4-methylphenyl)-4-methyl-1-prop-2-enylimidazol-2-amine.
| Compound Name | N-(2-bromo-5-chloro-4-methylphenyl)-4-methyl-1-prop-2-enylimidazol-2-amine |
|---|---|
| PubChem CID | 106580684 |
| Molecular Formula | C14H15BrClN3 |
| Molecular Weight | 340.65 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | N-(2-bromo-5-chloro-4-methylphenyl)-4-methyl-1-prop-2-enylimidazol-2-amine |
| SMILES | C=CCn1cc(C)nc1Nc1cc(Cl)c(C)cc1Br |
| InChI | InChI=1S/C14H15BrClN3/c1-4-5-19-8-10(3)17-14(19)18-13-7-12(16)9(2)6-11(13)15/h4,6-8H,1,5H2,2-3H3,(H,17,18) |
| InChIKey | JOLQYVRJSRYNBO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|