C11H21N3S — CID 106580940
N-butyl-1-(2-methylsulfanylpropyl)imidazol-2-amine (PubChem CID 106580940) has the molecular formula C11H21N3S and a molecular weight of 227.38 g/mol. Its IUPAC name is N-butyl-1-(2-methylsulfanylpropyl)imidazol-2-amine.
| Compound Name | N-butyl-1-(2-methylsulfanylpropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106580940 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | N-butyl-1-(2-methylsulfanylpropyl)imidazol-2-amine |
| SMILES | CCCCNc1nccn1CC(C)SC |
| InChI | InChI=1S/C11H21N3S/c1-4-5-6-12-11-13-7-8-14(11)9-10(2)15-3/h7-8,10H,4-6,9H2,1-3H3,(H,12,13) |
| InChIKey | JDLJPMCCCGAQET-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|