C12H19N3 — CID 106581460
4-methyl-N-(3-methylcyclobutyl)-1-prop-2-enylimidazol-2-amine (PubChem CID 106581460) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-methyl-N-(3-methylcyclobutyl)-1-prop-2-enylimidazol-2-amine.
| Compound Name | 4-methyl-N-(3-methylcyclobutyl)-1-prop-2-enylimidazol-2-amine |
|---|---|
| PubChem CID | 106581460 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 4-methyl-N-(3-methylcyclobutyl)-1-prop-2-enylimidazol-2-amine |
| SMILES | C=CCn1cc(C)nc1NC1CC(C)C1 |
| InChI | InChI=1S/C12H19N3/c1-4-5-15-8-10(3)13-12(15)14-11-6-9(2)7-11/h4,8-9,11H,1,5-7H2,2-3H3,(H,13,14) |
| InChIKey | AOFQMQLRFKZLBS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|