C12H12N2O4 — CID 10658167
6,9-dimethoxy-2,3-dihydro-[1,4]dioxino[2,3-b]quinoxaline (PubChem CID 10658167) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 6,9-dimethoxy-2,3-dihydro-[1,4]dioxino[2,3-b]quinoxaline.
| Compound Name | 6,9-dimethoxy-2,3-dihydro-[1,4]dioxino[2,3-b]quinoxaline |
|---|---|
| PubChem CID | 10658167 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 6,9-dimethoxy-2,3-dihydro-[1,4]dioxino[2,3-b]quinoxaline |
| SMILES | COc1ccc(OC)c2nc3c(nc12)OCCO3 |
| InChI | InChI=1S/C12H12N2O4/c1-15-7-3-4-8(16-2)10-9(7)13-11-12(14-10)18-6-5-17-11/h3-4H,5-6H2,1-2H3 |
| InChIKey | SGFAQMCXKYGCDD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |