C11H20O6 — CID 10658175
ethyl 2-(1,2-dihydroxy-4,4-dimethoxycyclopentyl)acetate (PubChem CID 10658175) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is ethyl 2-(1,2-dihydroxy-4,4-dimethoxycyclopentyl)acetate.
| Compound Name | ethyl 2-(1,2-dihydroxy-4,4-dimethoxycyclopentyl)acetate |
|---|---|
| PubChem CID | 10658175 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | ethyl 2-(1,2-dihydroxy-4,4-dimethoxycyclopentyl)acetate |
| SMILES | CCOC(=O)CC1(O)CC(OC)(OC)CC1O |
| InChI | InChI=1S/C11H20O6/c1-4-17-9(13)6-10(14)7-11(15-2,16-3)5-8(10)12/h8,12,14H,4-7H2,1-3H3 |
| InChIKey | QBTWGNLRDGWGCL-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|