About N-ethyl-2-methoxy-N-methyl-N'-(4-methyl-1-propan-2-ylimidazol-2-yl)propane-1,3-diamine
N-ethyl-2-methoxy-N-methyl-N'-(4-methyl-1-propan-2-ylimidazol-2-yl)propane-1,3-diamine (PubChem CID 106582043) has the molecular formula C14H28N4O
and a molecular weight of 268.40 g/mol. Its IUPAC name is N-ethyl-2-methoxy-N-methyl-N'-(4-methyl-1-propan-2-ylimidazol-2-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N-ethyl-2-methoxy-N-methyl-N'-(4-methyl-1-propan-2-ylimidazol-2-yl)propane-1,3-diamine |
| PubChem CID | 106582043 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | N-ethyl-2-methoxy-N-methyl-N'-(4-methyl-1-propan-2-ylimidazol-2-yl)propane-1,3-diamine |
| SMILES | CCN(C)CC(CNc1nc(C)cn1C(C)C)OC |
| InChI | InChI=1S/C14H28N4O/c1-7-17(5)10-13(19-6)8-15-14-16-12(4)9-18(14)11(2)3/h9,11,13H,7-8,10H2,1-6H3,(H,15,16) |
| InChIKey | XJSLYVYPMMIBKW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-ethyl-2-methoxy-N-methyl-N'-(4-methyl-1-propan-2-ylimidazol-2-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-methoxy-N-methyl-N'-(4-methyl-1-propan-2-ylimidazol-2-yl)propane-1,3-diamine?
The IUPAC name of N-ethyl-2-methoxy-N-methyl-N'-(4-methyl-1-propan-2-ylimidazol-2-yl)propane-1,3-diamine (CID 106582043) is N-ethyl-2-methoxy-N-methyl-N'-(4-methyl-1-propan-2-ylimidazol-2-yl)propane-1,3-diamine.
What is the SMILES notation for N-ethyl-2-methoxy-N-methyl-N'-(4-methyl-1-propan-2-ylimidazol-2-yl)propane-1,3-diamine?
The canonical SMILES for N-ethyl-2-methoxy-N-methyl-N'-(4-methyl-1-propan-2-ylimidazol-2-yl)propane-1,3-diamine is CCN(C)CC(CNc1nc(C)cn1C(C)C)OC.
What is the InChIKey of N-ethyl-2-methoxy-N-methyl-N'-(4-methyl-1-propan-2-ylimidazol-2-yl)propane-1,3-diamine?
The InChIKey is XJSLYVYPMMIBKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N4O/c1-7-17(5)10-13(19-6)8-15-14-16-12(4)9-18(14)11(2)3/h9,11,13H,7-8,10H2,1-6H3,(H,15,16).
What are the key properties of N-ethyl-2-methoxy-N-methyl-N'-(4-methyl-1-propan-2-ylimidazol-2-yl)propane-1,3-diamine?
N-ethyl-2-methoxy-N-methyl-N'-(4-methyl-1-propan-2-ylimidazol-2-yl)propane-1,3-diamine has a molecular weight of 268.40 g/mol, XLogP of 2.15, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-methoxy-N-methyl-N'-(4-methyl-1-propan-2-ylimidazol-2-yl)propane-1,3-diamine is sourced from PubChem (CID 106582043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).