C12H21N3S — CID 106582146
4-methyl-1-propyl-N-(thian-4-yl)imidazol-2-amine (PubChem CID 106582146) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is 4-methyl-1-propyl-N-(thian-4-yl)imidazol-2-amine.
| Compound Name | 4-methyl-1-propyl-N-(thian-4-yl)imidazol-2-amine |
|---|---|
| PubChem CID | 106582146 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4-methyl-1-propyl-N-(thian-4-yl)imidazol-2-amine |
| SMILES | CCCn1cc(C)nc1NC1CCSCC1 |
| InChI | InChI=1S/C12H21N3S/c1-3-6-15-9-10(2)13-12(15)14-11-4-7-16-8-5-11/h9,11H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | XKLZDGHOXXEQCE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |