C8H15N3S — CID 106582182
N-(1-ethylsulfanylpropan-2-yl)-1H-imidazol-2-amine (PubChem CID 106582182) has the molecular formula C8H15N3S and a molecular weight of 185.30 g/mol. Its IUPAC name is N-(1-ethylsulfanylpropan-2-yl)-1H-imidazol-2-amine.
| Compound Name | N-(1-ethylsulfanylpropan-2-yl)-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 106582182 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | N-(1-ethylsulfanylpropan-2-yl)-1H-imidazol-2-amine |
| SMILES | CCSCC(C)Nc1ncc[nH]1 |
| InChI | InChI=1S/C8H15N3S/c1-3-12-6-7(2)11-8-9-4-5-10-8/h4-5,7H,3,6H2,1-2H3,(H2,9,10,11) |
| InChIKey | KSJGWRMGLYGALU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |