C12H21N3O — CID 106582648
1-[1-(oxolan-3-yl)ethyl]-N-propylimidazol-2-amine (PubChem CID 106582648) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-[1-(oxolan-3-yl)ethyl]-N-propylimidazol-2-amine.
| Compound Name | 1-[1-(oxolan-3-yl)ethyl]-N-propylimidazol-2-amine |
|---|---|
| PubChem CID | 106582648 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 1-[1-(oxolan-3-yl)ethyl]-N-propylimidazol-2-amine |
| SMILES | CCCNc1nccn1C(C)C1CCOC1 |
| InChI | InChI=1S/C12H21N3O/c1-3-5-13-12-14-6-7-15(12)10(2)11-4-8-16-9-11/h6-7,10-11H,3-5,8-9H2,1-2H3,(H,13,14) |
| InChIKey | VOUMVMZYSBXGIK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |