C17H14O2 — CID 10658318
5-(naphthalen-1-ylmethyl)benzene-1,3-diol (PubChem CID 10658318) has the molecular formula C17H14O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 5-(naphthalen-1-ylmethyl)benzene-1,3-diol.
| Compound Name | 5-(naphthalen-1-ylmethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 10658318 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 5-(naphthalen-1-ylmethyl)benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(Cc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C17H14O2/c18-15-9-12(10-16(19)11-15)8-14-6-3-5-13-4-1-2-7-17(13)14/h1-7,9-11,18-19H,8H2 |
| InChIKey | SATDPLOZGULWMZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |