C15H26OSi — CID 10658360
trimethyl-[(3E,8E)-9-methylundeca-1,3,8,10-tetraen-5-yl]oxysilane (PubChem CID 10658360) has the molecular formula C15H26OSi and a molecular weight of 250.46 g/mol. Its IUPAC name is trimethyl-[(3E,8E)-9-methylundeca-1,3,8,10-tetraen-5-yl]oxysilane.
| Compound Name | trimethyl-[(3E,8E)-9-methylundeca-1,3,8,10-tetraen-5-yl]oxysilane |
|---|---|
| PubChem CID | 10658360 |
| Molecular Formula | C15H26OSi |
| Molecular Weight | 250.46 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | trimethyl-[(3E,8E)-9-methylundeca-1,3,8,10-tetraen-5-yl]oxysilane |
| SMILES | C=C/C=C/C(CC/C=C(\C)C=C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H26OSi/c1-7-9-12-15(16-17(4,5)6)13-10-11-14(3)8-2/h7-9,11-12,15H,1-2,10,13H2,3-6H3/b12-9+,14-11+ |
| InChIKey | JSYPVMNLKOHNRK-JZAGDRGGSA-N |
| XLogP | 4.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|