C11H13BrN4 — CID 106583906
(6-bromo-2-propan-2-ylquinazolin-4-yl)hydrazine (PubChem CID 106583906) has the molecular formula C11H13BrN4 and a molecular weight of 281.16 g/mol. Its IUPAC name is (6-bromo-2-propan-2-ylquinazolin-4-yl)hydrazine.
| Compound Name | (6-bromo-2-propan-2-ylquinazolin-4-yl)hydrazine |
|---|---|
| PubChem CID | 106583906 |
| Molecular Formula | C11H13BrN4 |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | (6-bromo-2-propan-2-ylquinazolin-4-yl)hydrazine |
| SMILES | CC(C)c1nc(NN)c2cc(Br)ccc2n1 |
| InChI | InChI=1S/C11H13BrN4/c1-6(2)10-14-9-4-3-7(12)5-8(9)11(15-10)16-13/h3-6H,13H2,1-2H3,(H,14,15,16) |
| InChIKey | ACBNWLMGPZRNHH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|