C14H20O4 — CID 10658459
methyl 3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-2,3,3a,4,6,7-hexahydroinden-4-yl]propanoate (PubChem CID 10658459) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is methyl 3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-2,3,3a,4,6,7-hexahydroinden-4-yl]propanoate.
| Compound Name | methyl 3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-2,3,3a,4,6,7-hexahydroinden-4-yl]propanoate |
|---|---|
| PubChem CID | 10658459 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | methyl 3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-2,3,3a,4,6,7-hexahydroinden-4-yl]propanoate |
| SMILES | COC(=O)CC[C@@H]1C(=O)CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C14H20O4/c1-14-8-7-11(15)9(3-6-13(17)18-2)10(14)4-5-12(14)16/h9-10H,3-8H2,1-2H3/t9-,10-,14-/m0/s1 |
| InChIKey | DWBXHJUNLMFRNZ-BHDSKKPTSA-N |
| XLogP | 1.90 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |