C11H13ClO3S — CID 106585025
2-(3-chlorophenyl)sulfonyl-1-cyclopropylethanol (PubChem CID 106585025) has the molecular formula C11H13ClO3S and a molecular weight of 260.74 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfonyl-1-cyclopropylethanol.
| Compound Name | 2-(3-chlorophenyl)sulfonyl-1-cyclopropylethanol |
|---|---|
| PubChem CID | 106585025 |
| Molecular Formula | C11H13ClO3S |
| Molecular Weight | 260.74 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 2-(3-chlorophenyl)sulfonyl-1-cyclopropylethanol |
| SMILES | O=S(=O)(CC(O)C1CC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H13ClO3S/c12-9-2-1-3-10(6-9)16(14,15)7-11(13)8-4-5-8/h1-3,6,8,11,13H,4-5,7H2 |
| InChIKey | FVGHTQUKQVJFME-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.74 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |