C11H20F3N3O2 — CID 106587065
3,3,3-trifluoro-N'-hydroxy-2-[[3-(methoxymethyl)piperidin-1-yl]methyl]propanimidamide (PubChem CID 106587065) has the molecular formula C11H20F3N3O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[[3-(methoxymethyl)piperidin-1-yl]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[[3-(methoxymethyl)piperidin-1-yl]methyl]propanimidamide |
|---|---|
| PubChem CID | 106587065 |
| Molecular Formula | C11H20F3N3O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[[3-(methoxymethyl)piperidin-1-yl]methyl]propanimidamide |
| SMILES | COCC1CCCN(CC(C(N)=NO)C(F)(F)F)C1 |
| InChI | InChI=1S/C11H20F3N3O2/c1-19-7-8-3-2-4-17(5-8)6-9(10(15)16-18)11(12,13)14/h8-9,18H,2-7H2,1H3,(H2,15,16) |
| InChIKey | WBQMYTOSUQRXCL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|