C13H20O5 — CID 10658725
(1E,3Z,5S)-5-[(2S,3R,6S)-2-ethoxy-6-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]penta-1,3-diene-1,5-diol (PubChem CID 10658725) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (1E,3Z,5S)-5-[(2S,3R,6S)-2-ethoxy-6-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]penta-1,3-diene-1,5-diol.
| Compound Name | (1E,3Z,5S)-5-[(2S,3R,6S)-2-ethoxy-6-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]penta-1,3-diene-1,5-diol |
|---|---|
| PubChem CID | 10658725 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (1E,3Z,5S)-5-[(2S,3R,6S)-2-ethoxy-6-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]penta-1,3-diene-1,5-diol |
| SMILES | CCO[C@H]1O[C@H](CO)C=C[C@@H]1[C@@H](O)/C=C\C=C\O |
| InChI | InChI=1S/C13H20O5/c1-2-17-13-11(7-6-10(9-15)18-13)12(16)5-3-4-8-14/h3-8,10-16H,2,9H2,1H3/b5-3-,8-4+/t10-,11+,12-,13-/m0/s1 |
| InChIKey | JUMTWUZTOIRCLX-PXBYXWMNSA-N |
| XLogP | 0.90 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|