C13H24O3Si — CID 10658762
prop-2-enyl (2S,3R)-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]pent-4-enoate (PubChem CID 10658762) has the molecular formula C13H24O3Si and a molecular weight of 256.42 g/mol. Its IUPAC name is prop-2-enyl (2S,3R)-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]pent-4-enoate.
| Compound Name | prop-2-enyl (2S,3R)-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]pent-4-enoate |
|---|---|
| PubChem CID | 10658762 |
| Molecular Formula | C13H24O3Si |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | prop-2-enyl (2S,3R)-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]pent-4-enoate |
| SMILES | C=CCOC(=O)[C@H]([C@H](O)C=C)[C@@H](C)[Si](C)(C)C |
| InChI | InChI=1S/C13H24O3Si/c1-7-9-16-13(15)12(11(14)8-2)10(3)17(4,5)6/h7-8,10-12,14H,1-2,9H2,3-6H3/t10-,11-,12+/m1/s1 |
| InChIKey | RPHOPYPWSHWBGJ-UTUOFQBUSA-N |
| XLogP | 2.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|