C14H19ClFNO — CID 106587689
1-[4-(chloromethyl)-2-fluorophenyl]-3-(methoxymethyl)piperidine (PubChem CID 106587689) has the molecular formula C14H19ClFNO and a molecular weight of 271.76 g/mol. Its IUPAC name is 1-[4-(chloromethyl)-2-fluorophenyl]-3-(methoxymethyl)piperidine.
| Compound Name | 1-[4-(chloromethyl)-2-fluorophenyl]-3-(methoxymethyl)piperidine |
|---|---|
| PubChem CID | 106587689 |
| Molecular Formula | C14H19ClFNO |
| Molecular Weight | 271.76 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-[4-(chloromethyl)-2-fluorophenyl]-3-(methoxymethyl)piperidine |
| SMILES | COCC1CCCN(c2ccc(CCl)cc2F)C1 |
| InChI | InChI=1S/C14H19ClFNO/c1-18-10-12-3-2-6-17(9-12)14-5-4-11(8-15)7-13(14)16/h4-5,7,12H,2-3,6,8-10H2,1H3 |
| InChIKey | JKFDXYXKDOYQHX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.76 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|