C15H23ClN2O — CID 106588358
3-(chloromethyl)-2-[3-(methoxymethyl)piperidin-1-yl]-4,6-dimethylpyridine (PubChem CID 106588358) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is 3-(chloromethyl)-2-[3-(methoxymethyl)piperidin-1-yl]-4,6-dimethylpyridine.
| Compound Name | 3-(chloromethyl)-2-[3-(methoxymethyl)piperidin-1-yl]-4,6-dimethylpyridine |
|---|---|
| PubChem CID | 106588358 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 3-(chloromethyl)-2-[3-(methoxymethyl)piperidin-1-yl]-4,6-dimethylpyridine |
| SMILES | COCC1CCCN(c2nc(C)cc(C)c2CCl)C1 |
| InChI | InChI=1S/C15H23ClN2O/c1-11-7-12(2)17-15(14(11)8-16)18-6-4-5-13(9-18)10-19-3/h7,13H,4-6,8-10H2,1-3H3 |
| InChIKey | JLLNDSGOCVLLNZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|