About 2-[1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethylidene]propanedinitrile
2-[1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethylidene]propanedinitrile (PubChem CID 10659001) has the molecular formula C12H12N4OS
and a molecular weight of 260.32 g/mol. Its IUPAC name is 2-[1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethylidene]propanedinitrile |
| PubChem CID | 10659001 |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 2-[1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethylidene]propanedinitrile |
| SMILES | CC(=C(C#N)C#N)c1cnc(N2CCOCC2)s1 |
| InChI | InChI=1S/C12H12N4OS/c1-9(10(6-13)7-14)11-8-15-12(18-11)16-2-4-17-5-3-16/h8H,2-5H2,1H3 |
| InChIKey | AFFDPKBQUFMJMJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 72.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethylidene]propanedinitrile?
The IUPAC name of 2-[1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethylidene]propanedinitrile (CID 10659001) is 2-[1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethylidene]propanedinitrile.
What is the SMILES notation for 2-[1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethylidene]propanedinitrile?
The canonical SMILES for 2-[1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethylidene]propanedinitrile is CC(=C(C#N)C#N)c1cnc(N2CCOCC2)s1.
What is the InChIKey of 2-[1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethylidene]propanedinitrile?
The InChIKey is AFFDPKBQUFMJMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4OS/c1-9(10(6-13)7-14)11-8-15-12(18-11)16-2-4-17-5-3-16/h8H,2-5H2,1H3.
What are the key properties of 2-[1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethylidene]propanedinitrile?
2-[1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethylidene]propanedinitrile has a molecular weight of 260.32 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethylidene]propanedinitrile is sourced from PubChem (CID 10659001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).