C15H24N2O3 — CID 106590951
2-(3-aminophenyl)-N,N-bis(2-methoxyethyl)propanamide (PubChem CID 106590951) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-(3-aminophenyl)-N,N-bis(2-methoxyethyl)propanamide.
| Compound Name | 2-(3-aminophenyl)-N,N-bis(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 106590951 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-(3-aminophenyl)-N,N-bis(2-methoxyethyl)propanamide |
| SMILES | COCCN(CCOC)C(=O)C(C)c1cccc(N)c1 |
| InChI | InChI=1S/C15H24N2O3/c1-12(13-5-4-6-14(16)11-13)15(18)17(7-9-19-2)8-10-20-3/h4-6,11-12H,7-10,16H2,1-3H3 |
| InChIKey | INYKEBCGFDUWSB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|