C16H24N2O3 — CID 106591897
2-(3-aminophenyl)-1-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propan-1-one (PubChem CID 106591897) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-(3-aminophenyl)-1-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propan-1-one.
| Compound Name | 2-(3-aminophenyl)-1-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 106591897 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2-(3-aminophenyl)-1-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propan-1-one |
| SMILES | CC(C(=O)N1CC(CO)OC(C)(C)C1)c1cccc(N)c1 |
| InChI | InChI=1S/C16H24N2O3/c1-11(12-5-4-6-13(17)7-12)15(20)18-8-14(9-19)21-16(2,3)10-18/h4-7,11,14,19H,8-10,17H2,1-3H3 |
| InChIKey | UHNXYANCIQJWRG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|