C18H20Si — CID 10659305
trimethyl-[(3Z,5Z)-6-methyl-8-phenylocta-3,5-dien-1,7-diynyl]silane (PubChem CID 10659305) has the molecular formula C18H20Si and a molecular weight of 264.44 g/mol. Its IUPAC name is trimethyl-[(3Z,5Z)-6-methyl-8-phenylocta-3,5-dien-1,7-diynyl]silane.
| Compound Name | trimethyl-[(3Z,5Z)-6-methyl-8-phenylocta-3,5-dien-1,7-diynyl]silane |
|---|---|
| PubChem CID | 10659305 |
| Molecular Formula | C18H20Si |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | trimethyl-[(3Z,5Z)-6-methyl-8-phenylocta-3,5-dien-1,7-diynyl]silane |
| SMILES | C/C(C#Cc1ccccc1)=C/C=C\C#C[Si](C)(C)C |
| InChI | InChI=1S/C18H20Si/c1-17(11-7-6-10-16-19(2,3)4)14-15-18-12-8-5-9-13-18/h5-9,11-13H,1-4H3/b7-6-,17-11- |
| InChIKey | NCLBRBANNLAURE-CQBFWGEDSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|