C16H28OSi — CID 10659308
trimethyl-[(1-propyl-4a,5,6,7,8,8a-hexahydronaphthalen-2-yl)oxy]silane (PubChem CID 10659308) has the molecular formula C16H28OSi and a molecular weight of 264.49 g/mol. Its IUPAC name is trimethyl-[(1-propyl-4a,5,6,7,8,8a-hexahydronaphthalen-2-yl)oxy]silane.
| Compound Name | trimethyl-[(1-propyl-4a,5,6,7,8,8a-hexahydronaphthalen-2-yl)oxy]silane |
|---|---|
| PubChem CID | 10659308 |
| Molecular Formula | C16H28OSi |
| Molecular Weight | 264.49 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | trimethyl-[(1-propyl-4a,5,6,7,8,8a-hexahydronaphthalen-2-yl)oxy]silane |
| SMILES | CCCC1=C(O[Si](C)(C)C)C=CC2CCCCC12 |
| InChI | InChI=1S/C16H28OSi/c1-5-8-15-14-10-7-6-9-13(14)11-12-16(15)17-18(2,3)4/h11-14H,5-10H2,1-4H3 |
| InChIKey | DBZNPGXEUICGDJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|