C12H18N2O3S — CID 106593692
4-[(6-methylsulfonyl-3-pyridinyl)amino]cyclohexan-1-ol (PubChem CID 106593692) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 4-[(6-methylsulfonyl-3-pyridinyl)amino]cyclohexan-1-ol.
| Compound Name | 4-[(6-methylsulfonyl-3-pyridinyl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106593692 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-[(6-methylsulfonyl-3-pyridinyl)amino]cyclohexan-1-ol |
| SMILES | CS(=O)(=O)c1ccc(NC2CCC(O)CC2)cn1 |
| InChI | InChI=1S/C12H18N2O3S/c1-18(16,17)12-7-4-10(8-13-12)14-9-2-5-11(15)6-3-9/h4,7-9,11,14-15H,2-3,5-6H2,1H3 |
| InChIKey | BNCQWGZVVKSKDZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |