C10H17N3O3S — CID 106593983
2-(aminomethyl)-N-(2-ethoxyethyl)pyridine-3-sulfonamide (PubChem CID 106593983) has the molecular formula C10H17N3O3S and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2-ethoxyethyl)pyridine-3-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-(2-ethoxyethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106593983 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-(aminomethyl)-N-(2-ethoxyethyl)pyridine-3-sulfonamide |
| SMILES | CCOCCNS(=O)(=O)c1cccnc1CN |
| InChI | InChI=1S/C10H17N3O3S/c1-2-16-7-6-13-17(14,15)10-4-3-5-12-9(10)8-11/h3-5,13H,2,6-8,11H2,1H3 |
| InChIKey | QIBGULPHVYFBOC-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|