C16H26O3 — CID 10659423
(1'R,2'S,4'aR,8'aS)-1',2',4'a-trimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydro-2H-naphthalene]-1'-carbaldehyde (PubChem CID 10659423) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (1'R,2'S,4'aR,8'aS)-1',2',4'a-trimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydro-2H-naphthalene]-1'-carbaldehyde.
| Compound Name | (1'R,2'S,4'aR,8'aS)-1',2',4'a-trimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydro-2H-naphthalene]-1'-carbaldehyde |
|---|---|
| PubChem CID | 10659423 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (1'R,2'S,4'aR,8'aS)-1',2',4'a-trimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydro-2H-naphthalene]-1'-carbaldehyde |
| SMILES | C[C@H]1CC[C@]2(C)[C@@H](CCCC23OCCO3)[C@]1(C)C=O |
| InChI | InChI=1S/C16H26O3/c1-12-6-8-15(3)13(14(12,2)11-17)5-4-7-16(15)18-9-10-19-16/h11-13H,4-10H2,1-3H3/t12-,13-,14+,15+/m0/s1 |
| InChIKey | XMFHIRFJOBYISD-BYNSBNAKSA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|