C6H6ClN3S — CID 106595002
4-chloro-2-(ethylamino)-1,3-thiazole-5-carbonitrile (PubChem CID 106595002) has the molecular formula C6H6ClN3S and a molecular weight of 187.66 g/mol. Its IUPAC name is 4-chloro-2-(ethylamino)-1,3-thiazole-5-carbonitrile.
| Compound Name | 4-chloro-2-(ethylamino)-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 106595002 |
| Molecular Formula | C6H6ClN3S |
| Molecular Weight | 187.66 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | 4-chloro-2-(ethylamino)-1,3-thiazole-5-carbonitrile |
| SMILES | CCNc1nc(Cl)c(C#N)s1 |
| InChI | InChI=1S/C6H6ClN3S/c1-2-9-6-10-5(7)4(3-8)11-6/h2H2,1H3,(H,9,10) |
| InChIKey | JIJCDXMRIOWFAU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.66 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |