C15H24O2S — CID 10659558
2-(octylsulfanylmethyl)benzene-1,3-diol (PubChem CID 10659558) has the molecular formula C15H24O2S and a molecular weight of 268.42 g/mol. Its IUPAC name is 2-(octylsulfanylmethyl)benzene-1,3-diol.
| Compound Name | 2-(octylsulfanylmethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 10659558 |
| Molecular Formula | C15H24O2S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-(octylsulfanylmethyl)benzene-1,3-diol |
| SMILES | CCCCCCCCSCc1c(O)cccc1O |
| InChI | InChI=1S/C15H24O2S/c1-2-3-4-5-6-7-11-18-12-13-14(16)9-8-10-15(13)17/h8-10,16-17H,2-7,11-12H2,1H3 |
| InChIKey | SVPZOXSBGOILFB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|